CAS 65998-44-9 appears in our catalog under these names: 5’-Hydroxyequol, >95% (HPLC), 5–OH–Equol. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol (CAS 65998-44-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol. InChIKey: QUQOSUMQYPIQFW-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol |
| InChIKey | QUQOSUMQYPIQFW-UHFFFAOYSA-N |
| SMILES | C1C(COC2=CC(=CC(=C21)O)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)