CAS 6602-56-8 appears in our catalog under these names: 2-Chloropyridine-3-sulfonic acid 95+%, 3-Pyridinesulfonic acid, 2-chloro-, 99%, 99%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-chloropyridine-3-sulfonic acid (CAS 6602-56-8) is a chemical compound with the molecular formula C5H4ClNO3S and a molecular weight of 193.61 g/mol. IUPAC name: 2-chloropyridine-3-sulfonic acid. InChIKey: VBJDRRWFZIWJOS-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO3S |
|---|---|
| Molecular weight | 193.61 g/mol |
| IUPAC name | 2-chloropyridine-3-sulfonic acid |
| InChIKey | VBJDRRWFZIWJOS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)S(=O)(=O)O |
Computed by PubChem (NCBI)