CAS 66021-75-8 is the registry number for ((2–Azidoethoxy)methyl)benzene. Offered by: GLPBio. Available pack sizes: 1g, 500mg.
2-azidoethoxymethylbenzene (CAS 66021-75-8) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 2-azidoethoxymethylbenzene. InChIKey: JNNJRIJFTCBFLX-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-azidoethoxymethylbenzene |
| InChIKey | JNNJRIJFTCBFLX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCN=[N+]=[N-] |
Computed by PubChem (NCBI)