CAS 66041-31-4 appears in our catalog under these names: 6-Chloro-3-oxo-2,3-dihydro-1H-indene-1-carboxylic acid, 98%, 5–Chloro–3–oxo–2，3–dihydro–1H–indene–1–carboxylic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
5-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid (CAS 66041-31-4) is a chemical compound with the molecular formula C10H7ClO3 and a molecular weight of 210.61 g/mol. IUPAC name: 5-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid. InChIKey: XVHIMUVCNJRARP-UHFFFAOYSA-N.
| Molecular formula | C10H7ClO3 |
|---|---|
| Molecular weight | 210.61 g/mol |
| IUPAC name | 5-chloro-3-oxo-1,2-dihydroindene-1-carboxylic acid |
| InChIKey | XVHIMUVCNJRARP-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(C1=O)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)