Products 66208-11-5
CAS 66208-11-5 is the registry number for Ifoxetine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol (CAS 66208-11-5) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol. InChIKey: ZHFIAFNZGWCLHU-YPMHNXCESA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol |
| InChIKey | ZHFIAFNZGWCLHU-YPMHNXCESA-N |
| SMILES | CC1=C(C(=CC=C1)O[C@H]2CCNC[C@H]2O)C |
Computed by PubChem (NCBI)