Products 6636-32-4

CAS 6636-32-4 is the registry number for 2-Phenyl-3,3-dimethyl-3H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

3,3-dimethyl-2-phenylindole (CAS 6636-32-4) is a chemical compound with the molecular formula C16H15N and a molecular weight of 221.30 g/mol. IUPAC name: 3,3-dimethyl-2-phenylindole. InChIKey: OVNJGKSNDVAJHA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15N
Molecular weight221.30 g/mol
IUPAC name3,3-dimethyl-2-phenylindole
InChIKeyOVNJGKSNDVAJHA-UHFFFAOYSA-N
SMILESCC1(C2=CC=CC=C2N=C1C3=CC=CC=C3)C

Computed by PubChem (NCBI)