CAS 66440-60-6 appears in our catalog under these names: 1,5-Dimethyl-1h-indole-2,3-dione, 95%, 1,5-Dimethyl-1H-indole-2,3-dione, 1,5-Dimethylindoline-2,3-dione 98%, 1,5-Dimethyl-1H-indole-2,3-dione, 98%, 98%, 1,5-Dimethyl-1H-indole-2,3-dione, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 100mg, 250mg, 5g, 10g.
1,5-dimethylindole-2,3-dione (CAS 66440-60-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 1,5-dimethylindole-2,3-dione. InChIKey: XRSLHTIRZNFPFF-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 1,5-dimethylindole-2,3-dione |
| InChIKey | XRSLHTIRZNFPFF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)C2=O)C |
Computed by PubChem (NCBI)