Products 66504-37-8
CAS 66504-37-8 is the registry number for rac-(1R,5S)-1-Phenyl-3-azabicyclo(3.1.0)hexane-2,4-dione. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(1R)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione (CAS 66504-37-8) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: (1R)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione. InChIKey: GBKKVNBNBVUCIV-LYNSQETBSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | (1R)-1-phenyl-3-azabicyclo[3.1.0]hexane-2,4-dione |
| InChIKey | GBKKVNBNBVUCIV-LYNSQETBSA-N |
| SMILES | C1C2[C@@]1(C(=O)NC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)