CAS 66514-93-0 appears in our catalog under these names: (S)-(-)-Methcathinone Hydrochloride, (S)-(-)-Methcathinone Hydrochloride 1.0 mg/ml in Methanol (as free base). Offered by: LoGiCal, Biosynth. Available pack sizes: 10mg, 1ml, 25mg, 50mg.
(2S)-2-(methylamino)-1-phenylpropan-1-one;hydrochloride (CAS 66514-93-0) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: (2S)-2-(methylamino)-1-phenylpropan-1-one;hydrochloride. InChIKey: LTJXNCHDKYZOSY-QRPNPIFTSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | (2S)-2-(methylamino)-1-phenylpropan-1-one;hydrochloride |
| InChIKey | LTJXNCHDKYZOSY-QRPNPIFTSA-N |
| SMILES | C[C@@H](C(=O)C1=CC=CC=C1)NC.Cl |
Computed by PubChem (NCBI)