CAS 6660-59-9 appears in our catalog under these names: 2,4-Dichloro-5-methylbenzoic acid, 95%, 2,4-Dichloro-5-methylbenzoic acid, 97%, 2,4-Dichloro-5-methylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
2,4-dichloro-5-methylbenzoic acid (CAS 6660-59-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,4-dichloro-5-methylbenzoic acid. InChIKey: VZSHNAFYRXEKKI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,4-dichloro-5-methylbenzoic acid |
| InChIKey | VZSHNAFYRXEKKI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)