CAS 66662-48-4 appears in our catalog under these names: 2-Chloro-4,6-dimethylnicotinic acid, 97%, 2-Chloro-4,6-dimethylnicotinic acid 97%, 2-Chloro-4,6-dimethylnicotinic acid, 97%, 97%, 2-Chloro-4,6-dimethylnicotinic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100g.
2-chloro-4,6-dimethylpyridine-3-carboxylic acid (CAS 66662-48-4) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-4,6-dimethylpyridine-3-carboxylic acid. InChIKey: CXNWZXGXVPYAST-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-4,6-dimethylpyridine-3-carboxylic acid |
| InChIKey | CXNWZXGXVPYAST-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)Cl)C |
Computed by PubChem (NCBI)