Products 66662-48-4
CAS 66662-48-4 appears in our catalog under these names: 2-Chloro-4,6-dimethylnicotinic acid, 97%, 2-Chloro-4,6-dimethylnicotinic acid, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 250mg.
2-chloro-4,6-dimethylpyridine-3-carboxylic acid (CAS 66662-48-4) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 2-chloro-4,6-dimethylpyridine-3-carboxylic acid. InChIKey: CXNWZXGXVPYAST-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 2-chloro-4,6-dimethylpyridine-3-carboxylic acid |
| InChIKey | CXNWZXGXVPYAST-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C(=O)O)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
2-chloro-4,6-dimethylpyridine-3-carboxylic acid, 2-Chloro-4,6-dimethylnicotinic acid, 2-Chloro-4,6-dimethyl-3-pyridinecarboxylic acid, 2-Chloro-4,6-dimethylnicotinicacid, 3-Pyridinecarboxylic acid, 2-chloro-4,6-dimethyl-, 2-Chloro-4,6-dimethyl-nicotinic acid, 4,6-dimethyl-2-chloronicotinic acid, 2-Chloro-4,6-dimethylnicotinic acid #, Pyridine-3-carboxylic acid, 2-chloro-4,6-dimethyl-