Products 667889-47-6
CAS 667889-47-6 is the registry number for BE2012. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-2-(4-tert-butylphenyl)quinazolin-4-one (CAS 667889-47-6) is a chemical compound with the molecular formula C18H19N3O and a molecular weight of 293.4 g/mol. IUPAC name: 3-amino-2-(4-tert-butylphenyl)quinazolin-4-one. InChIKey: YMCGEFBTFKOSSO-UHFFFAOYSA-N.
| Molecular formula | C18H19N3O |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 3-amino-2-(4-tert-butylphenyl)quinazolin-4-one |
| InChIKey | YMCGEFBTFKOSSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=O)N2N |
Computed by PubChem (NCBI)