CAS 66801-40-9 appears in our catalog under these names: Olopatadine Impurity 1, Olopatadine Impurity 17, 2-Decarboxymethyl-2-carboxy Isoxepac. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
11-oxo-6H-benzo[c][1]benzoxepine-2-carboxylic acid (CAS 66801-40-9) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 254.24 g/mol. IUPAC name: 11-oxo-6H-benzo[c][1]benzoxepine-2-carboxylic acid. InChIKey: COXWXMDASYKDSK-UHFFFAOYSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 11-oxo-6H-benzo[c][1]benzoxepine-2-carboxylic acid |
| InChIKey | COXWXMDASYKDSK-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)C3=C(O1)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)