Products 66818-22-2
CAS 66818-22-2 is the registry number for LC 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3bS,8bR)-3,3b,4,5,8,8b,9,10-octahydroindazolo[7,6-g]indazole (CAS 66818-22-2) is a chemical compound with the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. IUPAC name: (3bS,8bR)-3,3b,4,5,8,8b,9,10-octahydroindazolo[7,6-g]indazole. InChIKey: RTMZVYUACSCNRL-AOOOYVTPSA-N.
| Molecular formula | C12H14N4 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | (3bS,8bR)-3,3b,4,5,8,8b,9,10-octahydroindazolo[7,6-g]indazole |
| InChIKey | RTMZVYUACSCNRL-AOOOYVTPSA-N |
| SMILES | C1CC2=C([C@@H]3[C@@H]1C4=C(CC3)C=NN4)NN=C2 |
Computed by PubChem (NCBI)