Products 66938-30-5
CAS 66938-30-5 is the registry number for (2,4-Dichlorophenyl)(4-methoxyphenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(2,4-dichlorophenyl)-(4-methoxyphenyl)methanone (CAS 66938-30-5) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: (2,4-dichlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: PUVDARQEKWTLFT-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | PUVDARQEKWTLFT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)