Products 669715-28-0
CAS 669715-28-0 appears in our catalog under these names: 5-(4-Bromophenyl)-3H-1,3,4-oxadiazol-2-one, 98%, 5-(4-Bromophenyl)-1,3,4-oxadiazol-2(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
5-(4-bromophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 669715-28-0) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 5-(4-bromophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: BRZXIHOUCCMSGR-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 5-(4-bromophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | BRZXIHOUCCMSGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)O2)Br |
Computed by PubChem (NCBI)