CAS 669726-49-2 appears in our catalog under these names: 6-Chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid, 95%, 6-Chloro-2-(o-tolyl)quinoline-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid (CAS 669726-49-2) is a chemical compound with the molecular formula C17H12ClNO2 and a molecular weight of 297.7 g/mol. IUPAC name: 6-chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid. InChIKey: XJIIWWXZEKPFPP-UHFFFAOYSA-N.
| Molecular formula | C17H12ClNO2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 6-chloro-2-(2-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | XJIIWWXZEKPFPP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NC3=C(C=C(C=C3)Cl)C(=C2)C(=O)O |
Computed by PubChem (NCBI)