Products 66997-24-8

CAS 66997-24-8 appears in our catalog under these names: 3,3-Dimethyl-3H-indole-2-carboxylic acid, 95+%, 3,3-Dimethyl-3H-indole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3,3-dimethylindole-2-carboxylic acid (CAS 66997-24-8) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3,3-dimethylindole-2-carboxylic acid. InChIKey: LZTJAXFZWVNSRF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC name3,3-dimethylindole-2-carboxylic acid
InChIKeyLZTJAXFZWVNSRF-UHFFFAOYSA-N
SMILESCC1(C2=CC=CC=C2N=C1C(=O)O)C

Computed by PubChem (NCBI)