CAS 67-28-7 is the registry number for Nihydrazone. Offered by: TRC. Available pack sizes: 250mg.
N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide (CAS 67-28-7) is a chemical compound with the molecular formula C7H7N3O4 and a molecular weight of 197.15 g/mol. IUPAC name: N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide. InChIKey: ACFHHZJOAUZSJU-XBXARRHUSA-N.
| Molecular formula | C7H7N3O4 |
|---|---|
| Molecular weight | 197.15 g/mol |
| IUPAC name | N-[(E)-(5-nitrofuran-2-yl)methylideneamino]acetamide |
| InChIKey | ACFHHZJOAUZSJU-XBXARRHUSA-N |
| SMILES | CC(=O)N/N=C/C1=CC=C(O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)