Products 6703-27-1
CAS 6703-27-1 appears in our catalog under these names: 6-O-Acetyl Codeine, >95% (HPLC), Acetylcodeine, Acetylcodeine 0.1 mg/ml in Acetonitrile, Acetylcodeine 1.0 mg/ml in Acetonitrile. Offered by: TRC, Mikromol, LoGiCal, Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 1ml, 250mg.
[(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (CAS 6703-27-1) is a chemical compound with the molecular formula C20H23NO4 and a molecular weight of 341.4 g/mol. IUPAC name: [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate. InChIKey: MFXFQKMUCYHPFQ-BKRJIHRRSA-N.
| Molecular formula | C20H23NO4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [(4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| InChIKey | MFXFQKMUCYHPFQ-BKRJIHRRSA-N |
| SMILES | CC(=O)O[C@H]1C=C[C@H]2[C@H]3CC4=C5[C@]2([C@H]1OC5=C(C=C4)OC)CCN3C |
Computed by PubChem (NCBI)