CAS 67154-43-2 is the registry number for 1-(3,5-Dimethoxyphenyl)-1h-pyrrole-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3,5-dimethoxyphenyl)pyrrole-2,5-dione (CAS 67154-43-2) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 1-(3,5-dimethoxyphenyl)pyrrole-2,5-dione. InChIKey: LKRMOUHRAYRRAA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 1-(3,5-dimethoxyphenyl)pyrrole-2,5-dione |
| InChIKey | LKRMOUHRAYRRAA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N2C(=O)C=CC2=O)OC |
Computed by PubChem (NCBI)