CAS 67273-00-1 is the registry number for N,N,2-trimethyl-4-nitrobenzamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N,2-trimethyl-4-nitrobenzamide (CAS 67273-00-1) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: N,N,2-trimethyl-4-nitrobenzamide. InChIKey: IMNXFFJNFPGVJJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | N,N,2-trimethyl-4-nitrobenzamide |
| InChIKey | IMNXFFJNFPGVJJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)N(C)C |
Computed by PubChem (NCBI)