Products 67273-56-7
CAS 67273-56-7 is the registry number for NADH-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-propan-2-ylphenyl)-1H-benzimidazole (CAS 67273-56-7) is a chemical compound with the molecular formula C16H16N2 and a molecular weight of 236.31 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)-1H-benzimidazole. InChIKey: KZLWMCPIYIDTTK-UHFFFAOYSA-N.
| Molecular formula | C16H16N2 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)-1H-benzimidazole |
| InChIKey | KZLWMCPIYIDTTK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)