CAS 67278-27-7 appears in our catalog under these names: 6,7-Dimethoxyquinoline, 95%, 6,7–dimethoxyquinoline, 6,7-dimethoxyquinoline, 6,7-Dimethoxyquinoline 95%, 6,7-dimethoxyquinoline, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
6,7-dimethoxyquinoline (CAS 67278-27-7) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 6,7-dimethoxyquinoline. InChIKey: PCDPMVJGEGAJBI-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 6,7-dimethoxyquinoline |
| InChIKey | PCDPMVJGEGAJBI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=CC=N2)OC |
Computed by PubChem (NCBI)