CAS 67452-86-2 appears in our catalog under these names: 1-Benzoylpiperidin-3-ol, 95%, 1-Benzoylpiperidin-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 10g, 5g, 0,5g.
(3-hydroxypiperidin-1-yl)-phenylmethanone (CAS 67452-86-2) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (3-hydroxypiperidin-1-yl)-phenylmethanone. InChIKey: OAWOPHHIXXHCOX-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (3-hydroxypiperidin-1-yl)-phenylmethanone |
| InChIKey | OAWOPHHIXXHCOX-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)