Products 674786-37-9
CAS 674786-37-9 is the registry number for (Rac)-Deox B 7,4. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one (CAS 674786-37-9) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one. InChIKey: NGCXNVIQHUCZIT-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 3-[(3-hydroxy-4-methoxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one |
| InChIKey | NGCXNVIQHUCZIT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(CO2)CC3=CC(=C(C=C3)OC)O |
Computed by PubChem (NCBI)