Products 675602-94-5
CAS 675602-94-5 appears in our catalog under these names: Methyl 2-amino-4-(3-bromophenyl)thiophene-3-carboxylate, 97%, 2-Amino-4-(3-bromophenyl)thiophene-3-carboxylic acid methyl ester, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g.
Methyl 2-amino-4-(3-bromophenyl)thiophene-3-carboxylate (CAS 675602-94-5) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: methyl 2-amino-4-(3-bromophenyl)thiophene-3-carboxylate. InChIKey: PGCPOLOOWSKCFM-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | methyl 2-amino-4-(3-bromophenyl)thiophene-3-carboxylate |
| InChIKey | PGCPOLOOWSKCFM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=C1C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)