CAS 67580-85-2 appears in our catalog under these names: tert-Butyl (2R,3S)-2-amino-3-hydroxybutanoate, 98%, D-Threonine 1,1-Dimethylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate (CAS 67580-85-2) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate. InChIKey: XASPGLPXANLVTJ-NTSWFWBYSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate |
| InChIKey | XASPGLPXANLVTJ-NTSWFWBYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC(C)(C)C)N)O |
Computed by PubChem (NCBI)