Products 675831-64-8
CAS 675831-64-8 is the registry number for 3-(3-Oxocyclopentyl)indole-5-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-oxocyclopentyl)-1H-indole-5-carbonitrile (CAS 675831-64-8) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 3-(3-oxocyclopentyl)-1H-indole-5-carbonitrile. InChIKey: PCCIEBVCPXEIFS-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 3-(3-oxocyclopentyl)-1H-indole-5-carbonitrile |
| InChIKey | PCCIEBVCPXEIFS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CC1C2=CNC3=C2C=C(C=C3)C#N |
Computed by PubChem (NCBI)