CAS 676134-24-0 appears in our catalog under these names: (R)-6-isopropylchroman-4-amine hcl, 95%, (R)-6-Isopropylchroman-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4R)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 676134-24-0) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: (4R)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: MKGWECWQYNDBFZ-RFVHGSKJSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | (4R)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | MKGWECWQYNDBFZ-RFVHGSKJSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)OCC[C@H]2N.Cl |
Computed by PubChem (NCBI)