CAS 676134-25-1 appears in our catalog under these names: (4S)-6-(Propan-2-yl)-3,4-dihydro-2H-1-benzopyran-4-amine hydrochloride, (S)-6-isopropylchroman-4-amine hcl, 98%, 98%, (4s)-6-(Propan-2-yl)-3,4-dihydro-2h-1-benzopyran-4-amine hydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg, 2.5g.
(4S)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 676134-25-1) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: (4S)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: MKGWECWQYNDBFZ-MERQFXBCSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | (4S)-6-propan-2-yl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | MKGWECWQYNDBFZ-MERQFXBCSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)OCC[C@@H]2N.Cl |
Computed by PubChem (NCBI)