Products 676134-70-6
CAS 676134-70-6 is the registry number for 6-Bromoisochroman-4-ol, 95%. Offered by: Chemat. Available pack sizes: 1g.
6-bromo-3,4-dihydro-1H-isochromen-4-ol (CAS 676134-70-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 6-bromo-3,4-dihydro-1H-isochromen-4-ol. InChIKey: NUQIXXRSWGBNBJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 6-bromo-3,4-dihydro-1H-isochromen-4-ol |
| InChIKey | NUQIXXRSWGBNBJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(CO1)C=CC(=C2)Br)O |
Computed by PubChem (NCBI)