CAS 67625-37-0 appears in our catalog under these names: 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester, 97%, 97%, 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid ethyl ester, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
Ethyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate (CAS 67625-37-0) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: ethyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate. InChIKey: MWDCKDQQAFZDOH-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | ethyl 6-bromoimidazo[1,2-a]pyridine-2-carboxylate |
| InChIKey | MWDCKDQQAFZDOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=C(C=CC2=N1)Br |
Computed by PubChem (NCBI)