CAS 676348-31-5 appears in our catalog under these names: 3',4'-Dimethoxybiphenyl-3-carboxylic acid, 98%, 3',4'-Dimethoxy-[1,1'-biphenyl]-3-carboxylic acid 98%, 3',4'-Dimethoxybiphenyl-3-carboxylic acid, 98%, 98%, 3',4'-Dimethoxybiphenyl-3-carboxylic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(3,4-dimethoxyphenyl)benzoic acid (CAS 676348-31-5) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)benzoic acid. InChIKey: ZDBOLXDKLAYRRK-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)benzoic acid |
| InChIKey | ZDBOLXDKLAYRRK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)O)OC |
Computed by PubChem (NCBI)