Products 67814-27-1
CAS 67814-27-1 appears in our catalog under these names: Serratol, Serratol, 95.00%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 5mg, 25mg.
(3E,7E,11E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-3,7,11-trien-1-ol (CAS 67814-27-1) is a chemical compound with the molecular formula C20H34O and a molecular weight of 290.5 g/mol. IUPAC name: (3E,7E,11E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-3,7,11-trien-1-ol. InChIKey: ZVWXZFYWLABNOW-GDVLXBNMSA-N.
| Molecular formula | C20H34O |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | (3E,7E,11E)-4,8,12-trimethyl-1-propan-2-ylcyclotetradeca-3,7,11-trien-1-ol |
| InChIKey | ZVWXZFYWLABNOW-GDVLXBNMSA-N |
| SMILES | C/C/1=C\CC/C(=C/CC(CC/C(=C/CC1)/C)(C(C)C)O)/C |
Computed by PubChem (NCBI)