Products 678165-15-6
CAS 678165-15-6 appears in our catalog under these names: 4-(Chloromethyl)-2-(3-methoxyphenyl)-1,3-oxazole, 95%, 4-(Chloromethyl)-2-(3-methoxyphenyl)-1,3-oxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-(chloromethyl)-2-(3-methoxyphenyl)-1,3-oxazole (CAS 678165-15-6) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 4-(chloromethyl)-2-(3-methoxyphenyl)-1,3-oxazole. InChIKey: YPRUBERKIHANLG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(3-methoxyphenyl)-1,3-oxazole |
| InChIKey | YPRUBERKIHANLG-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC(=CO2)CCl |
Computed by PubChem (NCBI)