CAS 67858-49-5 appears in our catalog under these names: 5-(Methoxycarbonyl)-1-methyl-1H-pyrrole-3-carboxylic acid, 2-Methyl 1-methyl-1H-pyrrole-2,4-dicarboxylate, 97%, 97%, 5-(Methoxycarbonyl)-1-methyl-1H-pyrrole-3-carboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
5-methoxycarbonyl-1-methylpyrrole-3-carboxylic acid (CAS 67858-49-5) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 5-methoxycarbonyl-1-methylpyrrole-3-carboxylic acid. InChIKey: CBVPLFMDARRGMK-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 5-methoxycarbonyl-1-methylpyrrole-3-carboxylic acid |
| InChIKey | CBVPLFMDARRGMK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C(=O)OC)C(=O)O |
Computed by PubChem (NCBI)