Products 67967-14-0
CAS 67967-14-0 appears in our catalog under these names: 5-Bromo-1,7-naphthyridin-8(7H)-one, 96%, 5-Bromo-1,7-naphthyridin-8-ol, 96%, 5-Bromo-1,7-naphthyridin-8(7H)-one, 97%, 5-bromo-1,7-naphthyridin-8-ol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
5-bromo-7H-1,7-naphthyridin-8-one (CAS 67967-14-0) is a chemical compound with the molecular formula C8H5BrN2O and a molecular weight of 225.04 g/mol. IUPAC name: 5-bromo-7H-1,7-naphthyridin-8-one. InChIKey: OWSHCBPPPAJVAA-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 5-bromo-7H-1,7-naphthyridin-8-one |
| InChIKey | OWSHCBPPPAJVAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)NC=C2Br)N=C1 |
Computed by PubChem (NCBI)