Products 68-81-5
CAS 68-81-5 is the registry number for Iodinin. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,10-dioxidophenazine-5,10-diium-1,6-diol (CAS 68-81-5) is a chemical compound with the molecular formula C12H8N2O4 and a molecular weight of 244.20 g/mol. IUPAC name: 5,10-dioxidophenazine-5,10-diium-1,6-diol. InChIKey: NBMOVCYIGUDQJE-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O4 |
|---|---|
| Molecular weight | 244.20 g/mol |
| IUPAC name | 5,10-dioxidophenazine-5,10-diium-1,6-diol |
| InChIKey | NBMOVCYIGUDQJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)[N+](=C3C=CC=C(C3=[N+]2[O-])O)[O-] |
Computed by PubChem (NCBI)