CAS 6802-95-5 appears in our catalog under these names: Phenytoin Impurity E 95%, 2,2-Diphenylhydantoic Acid, >95% (HPLC), Phenytoin Impurity 5（Phenytoin EP Impurity E）, Phenytoin Impurity E, 2,2-Diphenyl-2-ureidoacetic acid, 98+%. Offered by: Ambeed, TRC, Hubei YoungXin, Chemat Brand, Mikromol. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg, 10mg, 25mg, 200mg.
2-(carbamoylamino)-2,2-diphenylacetic acid (CAS 6802-95-5) is a chemical compound with the molecular formula C15H14N2O3 and a molecular weight of 270.28 g/mol. IUPAC name: 2-(carbamoylamino)-2,2-diphenylacetic acid. InChIKey: UESCARMREGSPTP-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O3 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 2-(carbamoylamino)-2,2-diphenylacetic acid |
| InChIKey | UESCARMREGSPTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)O)NC(=O)N |
Computed by PubChem (NCBI)