Products 680215-71-8

CAS 680215-71-8 is the registry number for Isopropyl 2-(2-methyl-1,3-thiazol-4-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-(2-methyl-1,3-thiazol-4-yl)acetate (CAS 680215-71-8) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: propan-2-yl 2-(2-methyl-1,3-thiazol-4-yl)acetate. InChIKey: OMRPSBRLWKSORS-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2S
Molecular weight199.27 g/mol
IUPAC namepropan-2-yl 2-(2-methyl-1,3-thiazol-4-yl)acetate
InChIKeyOMRPSBRLWKSORS-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)CC(=O)OC(C)C

Computed by PubChem (NCBI)