Products 68099-99-0
CAS 68099-99-0 is the registry number for 2-Phenyl-4-(1-phenylethylidene)oxazol-5(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-4-(1-phenylethylidene)-1,3-oxazol-5-one (CAS 68099-99-0) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 2-phenyl-4-(1-phenylethylidene)-1,3-oxazol-5-one. InChIKey: TYPJAOYNIKQSCQ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-phenyl-4-(1-phenylethylidene)-1,3-oxazol-5-one |
| InChIKey | TYPJAOYNIKQSCQ-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)OC(=N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)