Products 68123-30-8

CAS 68123-30-8 appears in our catalog under these names: 9-Hydroxy-2H-furo[3,2-g]chromen-7(3H)-one, 95+%, Methoxsalen Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

9-hydroxy-2,3-dihydrofuro[3,2-g]chromen-7-one (CAS 68123-30-8) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 9-hydroxy-2,3-dihydrofuro[3,2-g]chromen-7-one. InChIKey: GWDMSCZQYHAETO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8O4
Molecular weight204.18 g/mol
IUPAC name9-hydroxy-2,3-dihydrofuro[3,2-g]chromen-7-one
InChIKeyGWDMSCZQYHAETO-UHFFFAOYSA-N
SMILESC1COC2=C1C=C3C=CC(=O)OC3=C2O

Computed by PubChem (NCBI)