CAS 68239-25-8 appears in our catalog under these names: 4'-Nitroacetanilide-2',3',5',6'-d4, 99 atom % D, min 98% Chemical Purity, N-(4-Nitrophenyl)acetamide-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
N-(2,3,5,6-tetradeuterio-4-nitrophenyl)acetamide (CAS 68239-25-8) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 184.19 g/mol. IUPAC name: N-(2,3,5,6-tetradeuterio-4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-QFFDRWTDSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | N-(2,3,5,6-tetradeuterio-4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)