CAS 104-04-1 appears in our catalog under these names: 4'-Nitroacetanilide, 98%, 4'–Nitroacetanilide, 4'-Nitroacetanilide, 98% , 4'-Nitroacetanilide, >99.0%(GC), 4'-Nitroacetanilide, 99%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 5g, 100g, 25g, 1g, 500g, 10g, 250g, 1x1000mg.
N-(4-nitrophenyl)acetamide (CAS 104-04-1) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: N-(4-nitrophenyl)acetamide. InChIKey: NQRLPDFELNCFHW-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | N-(4-nitrophenyl)acetamide |
| InChIKey | NQRLPDFELNCFHW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)