CAS 6826-24-0 appears in our catalog under these names: 5–Phenyloxazol–2–amine, 5-Phenyloxazol-2-amine 96%, 5-Phenyloxazol-2-amine, 98%, 98%, 5-Phenyloxazol-2-amine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
5-phenyl-1,3-oxazol-2-amine (CAS 6826-24-0) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 5-phenyl-1,3-oxazol-2-amine. InChIKey: IUHYFLKPKSFRCT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 5-phenyl-1,3-oxazol-2-amine |
| InChIKey | IUHYFLKPKSFRCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)N |
Computed by PubChem (NCBI)