Products 68261-19-8
CAS 68261-19-8 is the registry number for L-Aspartic acid-C13-1, 99.9%. Offered by: MedChemExpress. Available pack sizes: 5 mg.
(2S)-2-amino(313C)butanedioic acid (CAS 68261-19-8) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 134.10 g/mol. IUPAC name: (2S)-2-amino(313C)butanedioic acid. InChIKey: CKLJMWTZIZZHCS-IJGDANSWSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 134.10 g/mol |
| IUPAC name | (2S)-2-amino(313C)butanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-IJGDANSWSA-N |
| SMILES | [13CH2]([C@@H](C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)