Products 683219-04-7
CAS 683219-04-7 is the registry number for 3-{((tert-Butoxy)carbonyl)amino}-2-methyl-3-phenylpropanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 683219-04-7) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: RPHRJSPXJCPPIP-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 2-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | RPHRJSPXJCPPIP-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=CC=C1)NC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)