Products 683219-87-6

CAS 683219-87-6 is the registry number for 3-(Fmoc-NH)-octanoic acid. Offered by: Iris Biotech. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid (CAS 683219-87-6) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid. InChIKey: VRTIPYGJYHPEKN-UHFFFAOYSA-N.

Identity
Molecular formulaC23H27NO4
Molecular weight381.5 g/mol
IUPAC name3-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid
InChIKeyVRTIPYGJYHPEKN-UHFFFAOYSA-N
SMILESCCCCCC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)