Products 683226-93-9
CAS 683226-93-9 is the registry number for (S,Z)-2-methyl-N-(4-nitrobenzylidene)propane-2-sulfinamide, >97%, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(S)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide (CAS 683226-93-9) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: (S)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide. InChIKey: XNQNNFJWRGXIFE-KRWDZBQOSA-N.
| Molecular formula | C11H14N2O3S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | (S)-2-methyl-N-[(4-nitrophenyl)methylidene]propane-2-sulfinamide |
| InChIKey | XNQNNFJWRGXIFE-KRWDZBQOSA-N |
| SMILES | CC(C)(C)[S@](=O)N=CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)